| MolName | N-[anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]phosphoryl]aniline |
| MolecularFormula | C17H17N4O2P |
| Smiles | O=P(Nc1ccccc1)(Nc1ccccc1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C17H17N4O2P/c22-24(19-15-8-3-1-4-9-15,20-16-10-5-2-6-11-16)21-18-14-17-12-7-13-23-17/h1-14H,(H3,19,20,21,22) |
| InChIK | ZFKXONYPMYOGEL-UHFFFAOYSA-N |
| TotalMolweight | 340.322 |
| Molweight | 340.322 |
| MonoisotopicMass | 340.108913 |
| CLogP | 2.053 |
| CLogS | -4.872 |
| H Acceptors | 6 |
| H Donors | 3 |
| TotalSurfaceArea | 265.38 |
| Relative PSA | 0.29023 |
| PolarSurfaceArea | 88.47 |
| Druglikeness | -4.6765 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 9 |
| StereoCon |
Click to Load Molecule:
1 - N-[anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]phosphoryl]aniline | 2 - N-[anilino-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]phosphoryl]aniline