| MolName | N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C25H20N4O |
| Smiles | O=C(c1cnccc1)N/N=C\c(cc1)ccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20N4O/c30-25(21-8-7-17-26-19-21)28-27-18-20-13-15-24(16-14-20)29(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-19H,(H,28,30) |
| InChIK | ZFNAZIQXSJGEPZ-UHFFFAOYSA-N |
| TotalMolweight | 392.461 |
| Molweight | 392.461 |
| MonoisotopicMass | 392.163711 |
| CLogP | 4.7951 |
| CLogS | -7.102 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 315.57 |
| Relative PSA | 0.16012 |
| PolarSurfaceArea | 57.59 |
| Druglikeness | 5.0762 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 10 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]pyridine-3-carboxamide