| MolName | 2-[[(Z)-anthracen-9-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol |
| MolecularFormula | C24H19N3O3S |
| Smiles | OCCN(C(c1c2cccc1)=NS2(=O)=O)/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C24H19N3O3S/c28-14-13-27(24-21-11-5-6-12-23(21)31(29,30)26-24)25-16-22-19-9-3-1-7-17(19)15-18-8-2-4-10-20(18)22/h1-12,15-16,28H,13-14H2 |
| InChIK | ZFQYNXDMKYSTPX-UHFFFAOYSA-N |
| TotalMolweight | 429.499 |
| Molweight | 429.499 |
| MonoisotopicMass | 429.114712 |
| CLogP | 4.7449 |
| CLogS | -6.227 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 309.2 |
| Relative PSA | 0.22073 |
| PolarSurfaceArea | 90.71 |
| Druglikeness | 2.4697 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.41935 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 4 |
| Symmetricatoms | 7 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[(Z)-anthracen-9-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol | 2 - 2-[[(Z)-anthracen-9-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol