| MolName | N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C25H19N5OBrClS |
| Smiles | O=C(CSc1nnc(-c(cc2)ccc2Cl)n1-c1ccccc1)N/N=C\C(\Br)=C\c1ccccc1 |
| InChI | InChI=1S/C25H19BrClN5OS/c26-20(15-18-7-3-1-4-8-18)16-28-29-23(33)17-34-25-31-30-24(19-11-13-21(27)14-12-19)32(25)22-9-5-2-6-10-22/h1-16H,17H2,(H,29,33) |
| InChIK | ZFTLGLUXPDZKQD-UHFFFAOYSA-N |
| TotalMolweight | 552.883 |
| Molweight | 552.883 |
| MonoisotopicMass | 551.018218 |
| CLogP | 5.7487 |
| CLogS | -10.277 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 383.24 |
| Relative PSA | 0.21477 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 0.33331 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(Z)-[(Z)-2-bromo-3-phenylprop-2-enylidene]amino]-2-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide