| MolName | 2-(2-phenoxyethoxy)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| MolecularFormula | C23H19N2O3F3 |
| Smiles | O=C(c(cccc1)c1OCCOc1ccccc1)N/N=C\c1c(C(F)(F)F)cccc1 |
| InChI | InChI=1S/C23H19F3N2O3/c24-23(25,26)20-12-6-4-8-17(20)16-27-28-22(29)19-11-5-7-13-21(19)31-15-14-30-18-9-2-1-3-10-18/h1-13,16H,14-15H2,(H,28,29) |
| InChIK | ZGUQGABIPSNWEI-UHFFFAOYSA-N |
| TotalMolweight | 428.409 |
| Molweight | 428.409 |
| MonoisotopicMass | 428.134777 |
| CLogP | 5.4049 |
| CLogS | -5.767 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 323.73 |
| Relative PSA | 0.17301 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | -10.049 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-phenoxyethoxy)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide | 2 - 2-(2-phenoxyethoxy)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]benzamide