| MolName | N-[5-[2-[(2Z)-2-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide |
| MolecularFormula | C18H12N8O3Cl2S |
| Smiles | O=C(Cc1nnc(NC(c2ncn[nH]2)=O)s1)N/N=C\c1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C18H12Cl2N8O3S/c19-10-3-9(4-11(20)5-10)13-2-1-12(31-13)7-22-25-14(29)6-15-26-28-18(32-15)24-17(30)16-21-8-23-27-16/h1-5,7-8H,6H2,(H,25,29)(H,21,23,27)(H,24,28,30) |
| InChIK | ZHBZWUNSZZPMMR-UHFFFAOYSA-N |
| TotalMolweight | 491.318 |
| Molweight | 491.318 |
| MonoisotopicMass | 490.013011 |
| CLogP | 3.0005 |
| CLogS | -5.571 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 350.56 |
| Relative PSA | 0.43602 |
| PolarSurfaceArea | 179.29 |
| Druglikeness | 9.5824 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2Z)-2-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide | 2 - N-[5-[2-[(2Z)-2-[[5-(3,5-dichlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide