| MolName | 2-[2-[(Z)-[[3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C19H15N4O4Cl |
| Smiles | OC(COc1c(/C=N\NC(c2cc(-c(cc3)ccc3Cl)n[nH]2)=O)cccc1)=O |
| InChI | InChI=1S/C19H15ClN4O4/c20-14-7-5-12(6-8-14)15-9-16(23-22-15)19(27)24-21-10-13-3-1-2-4-17(13)28-11-18(25)26/h1-10H,11H2,(H,22,23)(H,24,27)(H,25,26) |
| InChIK | ZHJFXEIOUCJNPD-UHFFFAOYSA-N |
| TotalMolweight | 398.805 |
| Molweight | 398.805 |
| MonoisotopicMass | 398.078183 |
| CLogP | 2.5654 |
| CLogS | -4.625 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 298.36 |
| Relative PSA | 0.32548 |
| PolarSurfaceArea | 116.67 |
| Druglikeness | 5.5966 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[3-(4-chlorophenyl)-1H-pyrazole-5-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid