| MolName | 2-hydroxy-N-[(Z)-[(1S,4R)-3-phenyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]methylideneamino]benzamide |
| MolecularFormula | C21H18N2O2 |
| Smiles | Oc(cccc1)c1C(N/N=C\C([C@@H]1C=C[C@H]2C1)=C2c1ccccc1)=O |
| InChI | InChI=1S/C21H18N2O2/c24-19-9-5-4-8-17(19)21(25)23-22-13-18-15-10-11-16(12-15)20(18)14-6-2-1-3-7-14/h1-11,13,15-16,24H,12H2,(H,23,25)/t15-,16-/m1/s1 |
| InChIK | ZHJSRWVYYUMRRG-HZPDHXFCSA-N |
| TotalMolweight | 330.386 |
| Molweight | 330.386 |
| MonoisotopicMass | 330.136828 |
| CLogP | 3.224 |
| CLogS | -4.104 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 254.52 |
| Relative PSA | 0.19295 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 4.84 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| StereoCenters | 2 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[(1S,4R)-3-phenyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]methylideneamino]benzamide | 2 - 2-hydroxy-N-[(Z)-[(1S,4R)-3-phenyl-2-bicyclo[2.2.1]hepta-2,5-dienyl]methylideneamino]benzamide