| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine |
| MolecularFormula | C27H28N6O2 |
| Smiles | C(COCC1)N1c1cc(N/N=C\c2c(cccc3)c3cc3ccccc23)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C27H28N6O2/c1-3-7-22-20(5-1)17-21-6-2-4-8-23(21)24(22)19-28-31-25-18-26(32-9-13-34-14-10-32)30-27(29-25)33-11-15-35-16-12-33/h1-8,17-19H,9-16H2,(H,29,30,31) |
| InChIK | ZIBJMTUIEOATBN-UHFFFAOYSA-N |
| TotalMolweight | 468.559 |
| Molweight | 468.559 |
| MonoisotopicMass | 468.227374 |
| CLogP | 6.0768 |
| CLogS | -6.884 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 359.64 |
| Relative PSA | 0.20023 |
| PolarSurfaceArea | 75.11 |
| Druglikeness | 3.2985 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.42857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 10 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2,6-dimorpholin-4-ylpyrimidin-4-amine