| MolName | N-[(Z)-(5-piperidin-1-ylfuran-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C18H19N3O4 |
| Smiles | O=C(c(cc1)cc2c1OCO2)N/N=C\c1ccc(N2CCCCC2)o1 |
| InChI | InChI=1S/C18H19N3O4/c22-18(13-4-6-15-16(10-13)24-12-23-15)20-19-11-14-5-7-17(25-14)21-8-2-1-3-9-21/h4-7,10-11H,1-3,8-9,12H2,(H,20,22) |
| InChIK | ZIERWTWKGZOSBQ-UHFFFAOYSA-N |
| TotalMolweight | 341.366 |
| Molweight | 341.366 |
| MonoisotopicMass | 341.137557 |
| CLogP | 3.6861 |
| CLogS | -5.631 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 262.54 |
| Relative PSA | 0.2806 |
| PolarSurfaceArea | 76.3 |
| Druglikeness | 6.1711 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-piperidin-1-ylfuran-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide | 2 - N-[(Z)-(5-piperidin-1-ylfuran-2-yl)methylideneamino]-1,3-benzodioxole-5-carboxamide