| MolName | 2-(4-bromo-2-nitrophenoxy)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
| MolecularFormula | C13H9N4O6BrS |
| Smiles | [O-][N+](c1ccc(/C=N\NC(COc(ccc(Br)c2)c2[N+]([O-])=O)=O)s1)=O |
| InChI | InChI=1S/C13H9BrN4O6S/c14-8-1-3-11(10(5-8)17(20)21)24-7-12(19)16-15-6-9-2-4-13(25-9)18(22)23/h1-6H,7H2,(H,16,19) |
| InChIK | ZIGSTJYRWGBZGZ-UHFFFAOYSA-N |
| TotalMolweight | 429.206 |
| Molweight | 429.206 |
| MonoisotopicMass | 427.942617 |
| CLogP | 1.7147 |
| CLogS | -5.415 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 272.66 |
| Relative PSA | 0.46655 |
| PolarSurfaceArea | 170.57 |
| Druglikeness | -1.4222 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-bromo-2-nitrophenoxy)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide | 2 - 2-(4-bromo-2-nitrophenoxy)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide