| MolName | 4-(2,5-diphenylpyrrol-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]benzamide |
| MolecularFormula | C29H22N4O |
| Smiles | O=C(c(cc1)ccc1-n1c(-c2ccccc2)ccc1-c1ccccc1)N/N=C\c1cnccc1 |
| InChI | InChI=1S/C29H22N4O/c34-29(32-31-21-22-8-7-19-30-20-22)25-13-15-26(16-14-25)33-27(23-9-3-1-4-10-23)17-18-28(33)24-11-5-2-6-12-24/h1-21H,(H,32,34) |
| InChIK | ZIHDJZYQJIGNNM-UHFFFAOYSA-N |
| TotalMolweight | 442.521 |
| Molweight | 442.521 |
| MonoisotopicMass | 442.179361 |
| CLogP | 5.886 |
| CLogS | -8.795 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 354.23 |
| Relative PSA | 0.15202 |
| PolarSurfaceArea | 59.28 |
| Druglikeness | 5.4664 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2,5-diphenylpyrrol-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]benzamide | 2 - 4-(2,5-diphenylpyrrol-1-yl)-N-[(Z)-pyridin-3-ylmethylideneamino]benzamide