| MolName | 2-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C25H22N7OCl2F |
| Smiles | Fc(cc1)ccc1Nc1nc(N/N=C\c2ccc(-c3cccc(Cl)c3Cl)o2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C25H22Cl2FN7O/c26-20-6-4-5-19(22(20)27)21-12-11-18(36-21)15-29-34-24-31-23(30-17-9-7-16(28)8-10-17)32-25(33-24)35-13-2-1-3-14-35/h4-12,15H,1-3,13-14H2,(H2,30,31,32,33,34) |
| InChIK | ZINQLDZGOCTMCB-UHFFFAOYSA-N |
| TotalMolweight | 526.402 |
| Molweight | 526.402 |
| MonoisotopicMass | 525.12469 |
| CLogP | 8.8776 |
| CLogS | -9.151 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 388.98 |
| Relative PSA | 0.21852 |
| PolarSurfaceArea | 91.47 |
| Druglikeness | 3.1061 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine