| MolName | 2-nitro-6-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate |
| MolecularFormula | C17H13N4O4S |
| Smiles | [O-]c1c(/C=N\N(C=Nc2c3c(CCCC4)c4s2)C3=O)cccc1[N+]([O-])=O |
| InChI | InChI=1S/C17H14N4O4S/c22-15-10(4-3-6-12(15)21(24)25)8-19-20-9-18-16-14(17(20)23)11-5-1-2-7-13(11)26-16/h3-4,6,8-9,22H,1-2,5,7H2/p-1 |
| InChIK | ZJOUXUIKFKTCMF-UHFFFAOYSA-M |
| TotalMolweight | 369.38 |
| Molweight | 369.38 |
| MonoisotopicMass | 369.065751 |
| CLogP | 0.8397 |
| CLogS | -5.215 |
| H Acceptors | 8 |
| TotalSurfaceArea | 265.77 |
| Relative PSA | 0.39384 |
| PolarSurfaceArea | 142.15 |
| Druglikeness | -3.7694 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-nitro-6-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate | 2 - 2-nitro-6-[(Z)-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)iminomethyl]phenolate