| MolName | (Z)-1-[1-(4-iodophenyl)pyrrol-2-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C13H10N5I |
| Smiles | Ic(cc1)ccc1-n1c(/C=N\n2cnnc2)ccc1 |
| InChI | InChI=1S/C13H10IN5/c14-11-3-5-12(6-4-11)19-7-1-2-13(19)8-17-18-9-15-16-10-18/h1-10H |
| InChIK | ZJQZOTYRYWWZBA-UHFFFAOYSA-N |
| TotalMolweight | 363.157 |
| Molweight | 363.157 |
| MonoisotopicMass | 362.998093 |
| CLogP | 1.9043 |
| CLogS | -7.663 |
| H Acceptors | 5 |
| TotalSurfaceArea | 219.74 |
| Relative PSA | 0.21475 |
| PolarSurfaceArea | 48 |
| Druglikeness | 5.0824 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[1-(4-iodophenyl)pyrrol-2-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[1-(4-iodophenyl)pyrrol-2-yl]-N-(1,2,4-triazol-4-yl)methanimine