| MolName | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
| MolecularFormula | C38H29N6O4Br |
| Smiles | O=C(C(N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1OCc1ccccc1)=O)Nc(cccc1)c1C(Nc(cc1)ccc1Br)=O |
| InChI | InChI=1S/C38H29BrN6O4/c39-29-17-19-30(20-18-29)41-36(46)33-13-7-8-14-34(33)42-37(47)38(48)43-40-23-28-24-45(31-11-5-2-6-12-31)44-35(28)27-15-21-32(22-16-27)49-25-26-9-3-1-4-10-26/h1-24H,25H2,(H,41,46)(H,42,47)(H,43,48) |
| InChIK | ZJWCNSQANLEJAC-UHFFFAOYSA-N |
| TotalMolweight | 713.59 |
| Molweight | 713.59 |
| MonoisotopicMass | 712.143365 |
| CLogP | 6.2837 |
| CLogS | -8.725 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 514.8 |
| Relative PSA | 0.21921 |
| PolarSurfaceArea | 126.71 |
| Druglikeness | 3.0019 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.55102 |
| Fragments | 1 |
| Non HAtoms | 49 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 11 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 35 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide | 2 - N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[(Z)-[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide