| MolName | 5-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one |
| MolecularFormula | C11H8N5OF3 |
| Smiles | O=C(NN=C1)N=C1N/N=C\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H8F3N5O/c12-11(13,14)8-3-1-7(2-4-8)5-15-18-9-6-16-19-10(20)17-9/h1-6H,(H2,17,18,19,20) |
| InChIK | ZJYQHEOWSFHDDI-UHFFFAOYSA-N |
| TotalMolweight | 283.213 |
| Molweight | 283.213 |
| MonoisotopicMass | 283.068094 |
| CLogP | 1.7914 |
| CLogS | -4.244 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 202.38 |
| Relative PSA | 0.34831 |
| PolarSurfaceArea | 78.21 |
| Druglikeness | -3.4589 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 5-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one | 2 - 5-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one