| MolName | 2-[2-bromo-6-chloro-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid |
| MolecularFormula | C14H10N2O4BrClS |
| Smiles | OC(COc(c(Cl)cc(/C=N\NC(c1cccs1)=O)c1)c1Br)=O |
| InChI | InChI=1S/C14H10BrClN2O4S/c15-9-4-8(5-10(16)13(9)22-7-12(19)20)6-17-18-14(21)11-2-1-3-23-11/h1-6H,7H2,(H,18,21)(H,19,20) |
| InChIK | ZKCXTLXXELLTCT-UHFFFAOYSA-N |
| TotalMolweight | 417.666 |
| Molweight | 417.666 |
| MonoisotopicMass | 415.923316 |
| CLogP | 3.4594 |
| CLogS | -5.094 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 264.84 |
| Relative PSA | 0.34931 |
| PolarSurfaceArea | 116.23 |
| Druglikeness | 4.3946 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-bromo-6-chloro-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid | 2 - 2-[2-bromo-6-chloro-4-[(Z)-(thiophene-2-carbonylhydrazinylidene)methyl]phenoxy]acetic acid