| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide |
| MolecularFormula | C11H9N5OCl2 |
| Smiles | O=C(Cn1ncnc1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C11H9Cl2N5O/c12-9-2-1-8(10(13)3-9)4-15-17-11(19)5-18-7-14-6-16-18/h1-4,6-7H,5H2,(H,17,19) |
| InChIK | ZLGDFFQGZWVKQJ-UHFFFAOYSA-N |
| TotalMolweight | 298.132 |
| Molweight | 298.132 |
| MonoisotopicMass | 297.018414 |
| CLogP | 1.8468 |
| CLogS | -3.804 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 218.31 |
| Relative PSA | 0.29692 |
| PolarSurfaceArea | 72.17 |
| Druglikeness | 6.4881 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-(1,2,4-triazol-1-yl)acetamide