| MolName | N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-phenylbutanediamide |
| MolecularFormula | C17H16N3O2Cl |
| Smiles | O=C(CCC(N/N=C\c(cccc1)c1Cl)=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-15-9-5-4-6-13(15)12-19-21-17(23)11-10-16(22)20-14-7-2-1-3-8-14/h1-9,12H,10-11H2,(H,20,22)(H,21,23) |
| InChIK | ZLGQFYYDPSENFM-UHFFFAOYSA-N |
| TotalMolweight | 329.786 |
| Molweight | 329.786 |
| MonoisotopicMass | 329.093104 |
| CLogP | 3.6587 |
| CLogS | -4.801 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 259.14 |
| Relative PSA | 0.2335 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 3.6212 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-phenylbutanediamide | 2 - N'-[(Z)-(2-chlorophenyl)methylideneamino]-N-phenylbutanediamide