| MolName | 4-(2,4-dichlorophenoxy)-N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]butanamide |
| MolecularFormula | C17H17N3O3Cl2S |
| Smiles | O=C(CCCOc(ccc(Cl)c1)c1Cl)NCC(N/N=C\c1cccs1)=O |
| InChI | InChI=1S/C17H17Cl2N3O3S/c18-12-5-6-15(14(19)9-12)25-7-1-4-16(23)20-11-17(24)22-21-10-13-3-2-8-26-13/h2-3,5-6,8-10H,1,4,7,11H2,(H,20,23)(H,22,24) |
| InChIK | ZLIBMHCVAMEGTQ-UHFFFAOYSA-N |
| TotalMolweight | 414.312 |
| Molweight | 414.312 |
| MonoisotopicMass | 413.036766 |
| CLogP | 3.8476 |
| CLogS | -5.29 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 308.02 |
| Relative PSA | 0.29501 |
| PolarSurfaceArea | 108.03 |
| Druglikeness | 2.9745 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73077 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2,4-dichlorophenoxy)-N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]butanamide | 2 - 4-(2,4-dichlorophenoxy)-N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]butanamide