| MolName | N-(2-bromophenyl)-N'-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| MolecularFormula | C23H18N4O4BrCl |
| Smiles | O=C(COc1ccc(/C=N\NC(C(Nc(cccc2)c2Br)=O)=O)cc1)Nc(cccc1)c1Cl |
| InChI | InChI=1S/C23H18BrClN4O4/c24-17-5-1-3-7-19(17)28-22(31)23(32)29-26-13-15-9-11-16(12-10-15)33-14-21(30)27-20-8-4-2-6-18(20)25/h1-13H,14H2,(H,27,30)(H,28,31)(H,29,32) |
| InChIK | ZLIKGQXKRZUAMA-UHFFFAOYSA-N |
| TotalMolweight | 529.777 |
| Molweight | 529.777 |
| MonoisotopicMass | 528.019994 |
| CLogP | 4.1975 |
| CLogS | -6.387 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 362.98 |
| Relative PSA | 0.26175 |
| PolarSurfaceArea | 108.89 |
| Druglikeness | 1.7854 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-bromophenyl)-N'-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide | 2 - N-(2-bromophenyl)-N'-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide