| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]pyridin-2-amine |
| MolecularFormula | C12H10N3F |
| Smiles | Fc1ccc(/C=N\Nc2ncccc2)cc1 |
| InChI | InChI=1S/C12H10FN3/c13-11-6-4-10(5-7-11)9-15-16-12-3-1-2-8-14-12/h1-9H,(H,14,16) |
| InChIK | ZMDJCOLPONQRAQ-UHFFFAOYSA-N |
| TotalMolweight | 215.23 |
| Molweight | 215.23 |
| MonoisotopicMass | 215.085875 |
| CLogP | 4.2922 |
| CLogS | -3.193 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 174.35 |
| Relative PSA | 0.19467 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | 1.0825 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]pyridin-2-amine | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]pyridin-2-amine