| MolName | 2-(4-chlorophenyl)-N-[(Z)-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]quinoline-4-carboxamide |
| MolecularFormula | C28H18N3O3Cl3 |
| Smiles | O=C(c1cc(-c(cc2)ccc2Cl)nc2ccccc12)N/N=C\c1ccc(COc(cc2)cc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C28H18Cl3N3O3/c29-18-7-5-17(6-8-18)27-14-23(22-3-1-2-4-26(22)33-27)28(35)34-32-15-20-9-10-21(37-20)16-36-19-11-12-24(30)25(31)13-19/h1-15H,16H2,(H,34,35) |
| InChIK | ZMGNMXBFGQGELJ-UHFFFAOYSA-N |
| TotalMolweight | 550.828 |
| Molweight | 550.828 |
| MonoisotopicMass | 549.041373 |
| CLogP | 7.6766 |
| CLogS | -9.46 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 399.58 |
| Relative PSA | 0.17791 |
| PolarSurfaceArea | 76.72 |
| Druglikeness | 6.2818 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59459 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenyl)-N-[(Z)-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]quinoline-4-carboxamide | 2 - 2-(4-chlorophenyl)-N-[(Z)-[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]methylideneamino]quinoline-4-carboxamide