| MolName | 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C21H15N3O4Cl2 |
| Smiles | [O-][N+](c1c(/C=N\NC(C(c(cc2)ccc2Cl)(c(cc2)ccc2Cl)O)=O)cccc1)=O |
| InChI | InChI=1S/C21H15Cl2N3O4/c22-17-9-5-15(6-10-17)21(28,16-7-11-18(23)12-8-16)20(27)25-24-13-14-3-1-2-4-19(14)26(29)30/h1-13,28H,(H,25,27) |
| InChIK | ZMNZZJMPKFSFBR-UHFFFAOYSA-N |
| TotalMolweight | 444.273 |
| Molweight | 444.273 |
| MonoisotopicMass | 443.043961 |
| CLogP | 3.7723 |
| CLogS | -6.359 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 318.02 |
| Relative PSA | 0.25008 |
| PolarSurfaceArea | 107.51 |
| Druglikeness | 0.35128 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 9 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide | 2 - 2,2-bis(4-chlorophenyl)-2-hydroxy-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide