| MolName | [4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| MolecularFormula | C22H15N3O6Cl2 |
| Smiles | [O-][N+](c(cc1)ccc1C(Oc1ccc(/C=N\NC(COc(ccc(Cl)c2)c2Cl)=O)cc1)=O)=O |
| InChI | InChI=1S/C22H15Cl2N3O6/c23-16-5-10-20(19(24)11-16)32-13-21(28)26-25-12-14-1-8-18(9-2-14)33-22(29)15-3-6-17(7-4-15)27(30)31/h1-12H,13H2,(H,26,28) |
| InChIK | ZMTOKALIRVHXHX-UHFFFAOYSA-N |
| TotalMolweight | 488.282 |
| Molweight | 488.282 |
| MonoisotopicMass | 487.033791 |
| CLogP | 4.4974 |
| CLogS | -6.903 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 352.77 |
| Relative PSA | 0.28197 |
| PolarSurfaceArea | 122.81 |
| Druglikeness | -1.0267 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69697 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate | 2 - [4-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate