| MolName | 2-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]iminomethyl]-4-nitrophenolate |
| MolecularFormula | C20H12N3O4Cl2 |
| Smiles | [O-]c(cc1)c(/C=N/c(cc2)ccc2NC(c(ccc(Cl)c2)c2Cl)=O)cc1[N+]([O-])=O |
| InChI | InChI=1S/C20H13Cl2N3O4/c21-13-1-7-17(18(22)10-13)20(27)24-15-4-2-14(3-5-15)23-11-12-9-16(25(28)29)6-8-19(12)26/h1-11,26H,(H,24,27)/p-1 |
| InChIK | ZNFGQRAUUMVOFW-UHFFFAOYSA-M |
| TotalMolweight | 429.238 |
| Molweight | 429.238 |
| MonoisotopicMass | 428.020486 |
| CLogP | 2.5476 |
| CLogS | -6.306 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 308.79 |
| Relative PSA | 0.26138 |
| PolarSurfaceArea | 110.34 |
| Druglikeness | -3.7489 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]iminomethyl]-4-nitrophenolate | 2 - 2-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]iminomethyl]-4-nitrophenolate