| MolName | 4-chloro-N-[2-[(2Z)-2-[(2-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| MolecularFormula | C16H13N4O4Cl |
| Smiles | [O-][N+](c1c(/C=N\NC(CNC(c(cc2)ccc2Cl)=O)=O)cccc1)=O |
| InChI | InChI=1S/C16H13ClN4O4/c17-13-7-5-11(6-8-13)16(23)18-10-15(22)20-19-9-12-3-1-2-4-14(12)21(24)25/h1-9H,10H2,(H,18,23)(H,20,22) |
| InChIK | ZNKQMESISHKONW-UHFFFAOYSA-N |
| TotalMolweight | 360.756 |
| Molweight | 360.756 |
| MonoisotopicMass | 360.062533 |
| CLogP | 1.9697 |
| CLogS | -4.684 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 269.05 |
| Relative PSA | 0.33797 |
| PolarSurfaceArea | 116.38 |
| Druglikeness | 0.24684 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[2-[(2Z)-2-[(2-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide | 2 - 4-chloro-N-[2-[(2Z)-2-[(2-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide