| MolName | 2-[4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C17H15N3O7 |
| Smiles | [O-][N+](c(cccc1)c1OCC(N/N=C\c(cc1)ccc1OCC(O)=O)=O)=O |
| InChI | InChI=1S/C17H15N3O7/c21-16(10-27-15-4-2-1-3-14(15)20(24)25)19-18-9-12-5-7-13(8-6-12)26-11-17(22)23/h1-9H,10-11H2,(H,19,21)(H,22,23) |
| InChIK | ZNWPIYLSKVHPKN-UHFFFAOYSA-N |
| TotalMolweight | 373.32 |
| Molweight | 373.32 |
| MonoisotopicMass | 373.091002 |
| CLogP | 0.9149 |
| CLogS | -3.754 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 282.28 |
| Relative PSA | 0.39879 |
| PolarSurfaceArea | 143.04 |
| Druglikeness | -0.86466 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[4-[(Z)-[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid