| MolName | 1-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-(3-chlorophenyl)thiourea |
| MolecularFormula | C24H25N4OClS |
| Smiles | S=C(Nc1cccc(Cl)c1)N/N=C\C(CC/C1=C/c2ccccc2)=C1N1CCOCC1 |
| InChI | InChI=1S/C24H25ClN4OS/c25-21-7-4-8-22(16-21)27-24(31)28-26-17-20-10-9-19(15-18-5-2-1-3-6-18)23(20)29-11-13-30-14-12-29/h1-8,15-17H,9-14H2,(H2,27,28,31) |
| InChIK | ZOBCEFVYZQOEHN-UHFFFAOYSA-N |
| TotalMolweight | 453.009 |
| Molweight | 453.009 |
| MonoisotopicMass | 452.143758 |
| CLogP | 4.7777 |
| CLogS | -5.623 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 352.32 |
| Relative PSA | 0.21566 |
| PolarSurfaceArea | 80.98 |
| Druglikeness | 3.2247 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-(3-chlorophenyl)thiourea | 2 - 1-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]-3-(3-chlorophenyl)thiourea