| MolName | N'-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-N-(3,4-dichlorophenyl)oxamide |
| MolecularFormula | C15H9N4O4Cl3 |
| Smiles | [O-][N+](c(cc(/C=N\NC(C(Nc(cc1)cc(Cl)c1Cl)=O)=O)cc1)c1Cl)=O |
| InChI | InChI=1S/C15H9Cl3N4O4/c16-10-4-2-9(6-12(10)18)20-14(23)15(24)21-19-7-8-1-3-11(17)13(5-8)22(25)26/h1-7H,(H,20,23)(H,21,24) |
| InChIK | ZOROUFWNWCDTKH-UHFFFAOYSA-N |
| TotalMolweight | 415.619 |
| Molweight | 415.619 |
| MonoisotopicMass | 413.968937 |
| CLogP | 3.0403 |
| CLogS | -6.193 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 286.13 |
| Relative PSA | 0.31779 |
| PolarSurfaceArea | 116.38 |
| Druglikeness | -1.3809 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-N-(3,4-dichlorophenyl)oxamide | 2 - N'-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-N-(3,4-dichlorophenyl)oxamide