| MolName | N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]benzamide |
| MolecularFormula | C24H25N3O2 |
| Smiles | O=C(c1ccccc1)N/N=C\C(CC/C1=C/c2ccccc2)=C1N1CCOCC1 |
| InChI | InChI=1S/C24H25N3O2/c28-24(20-9-5-2-6-10-20)26-25-18-22-12-11-21(17-19-7-3-1-4-8-19)23(22)27-13-15-29-16-14-27/h1-10,17-18H,11-16H2,(H,26,28) |
| InChIK | ZPCUBGYRLUQIKO-UHFFFAOYSA-N |
| TotalMolweight | 387.482 |
| Molweight | 387.482 |
| MonoisotopicMass | 387.194677 |
| CLogP | 3.7811 |
| CLogS | -4.287 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 310.48 |
| Relative PSA | 0.15962 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 4.6644 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]benzamide | 2 - N-[(Z)-[(3Z)-3-benzylidene-2-morpholin-4-ylcyclopenten-1-yl]methylideneamino]benzamide