| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]piperidine-4-carboxamide |
| MolecularFormula | C24H25N5O6 |
| Smiles | O=C(CN(CC1)CCC1C(N/N=C\c(cc1)cc2c1OCO2)=O)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C24H25N5O6/c30-23(27-25-11-16-1-3-19-21(9-16)34-14-32-19)13-29-7-5-18(6-8-29)24(31)28-26-12-17-2-4-20-22(10-17)35-15-33-20/h1-4,9-12,18H,5-8,13-15H2,(H,27,30)(H,28,31) |
| InChIK | ZPDYTTIPCCATPJ-UHFFFAOYSA-N |
| TotalMolweight | 479.492 |
| Molweight | 479.492 |
| MonoisotopicMass | 479.180485 |
| CLogP | 3.457 |
| CLogS | -5.779 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 359.58 |
| Relative PSA | 0.3214 |
| PolarSurfaceArea | 123.08 |
| Druglikeness | 9.1935 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65714 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]piperidine-4-carboxamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]piperidine-4-carboxamide