| MolName | (Z)-1-(furan-2-yl)-N-pyridin-2-ylmethanimine |
| MolecularFormula | C10H8N2O |
| Smiles | C(c1ccco1)=N\c1ncccc1 |
| InChI | InChI=1S/C10H8N2O/c1-2-6-11-10(5-1)12-8-9-4-3-7-13-9/h1-8H |
| InChIK | ZPETXEXCDQPGMP-UHFFFAOYSA-N |
| TotalMolweight | 172.187 |
| Molweight | 172.187 |
| MonoisotopicMass | 172.063663 |
| CLogP | 1.5726 |
| CLogS | -2.57 |
| H Acceptors | 3 |
| TotalSurfaceArea | 146.23 |
| Relative PSA | 0.25022 |
| PolarSurfaceArea | 38.39 |
| Druglikeness | -0.14985 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(furan-2-yl)-N-pyridin-2-ylmethanimine | 2 - (Z)-1-(furan-2-yl)-N-pyridin-2-ylmethanimine