| MolName | 2-[(4-chlorophenyl)methoxy]-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]benzamide |
| MolecularFormula | C21H15N2O2Cl3 |
| Smiles | O=C(c(cccc1)c1OCc(cc1)ccc1Cl)N/N=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H15Cl3N2O2/c22-16-10-8-14(9-11-16)13-28-19-7-2-1-5-17(19)21(27)26-25-12-15-4-3-6-18(23)20(15)24/h1-12H,13H2,(H,26,27) |
| InChIK | ZPFGIWWDSAPJCR-UHFFFAOYSA-N |
| TotalMolweight | 433.721 |
| Molweight | 433.721 |
| MonoisotopicMass | 432.019909 |
| CLogP | 6.3677 |
| CLogS | -7.27 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 316.77 |
| Relative PSA | 0.14525 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 4.0514 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(4-chlorophenyl)methoxy]-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]benzamide | 2 - 2-[(4-chlorophenyl)methoxy]-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]benzamide