| MolName | (Z)-1-(4-bromophenyl)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine |
| MolecularFormula | C16H12N4BrClS |
| Smiles | Clc1c(CSc2nncn2/N=C\c(cc2)ccc2Br)cccc1 |
| InChI | InChI=1S/C16H12BrClN4S/c17-14-7-5-12(6-8-14)9-20-22-11-19-21-16(22)23-10-13-3-1-2-4-15(13)18/h1-9,11H,10H2 |
| InChIK | ZPFYYFOLPLHJBA-UHFFFAOYSA-N |
| TotalMolweight | 407.722 |
| Molweight | 407.722 |
| MonoisotopicMass | 405.965454 |
| CLogP | 4.763 |
| CLogS | -8.078 |
| H Acceptors | 4 |
| TotalSurfaceArea | 269.56 |
| Relative PSA | 0.21446 |
| PolarSurfaceArea | 68.37 |
| Druglikeness | 2.2039 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-bromophenyl)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine | 2 - (Z)-1-(4-bromophenyl)-N-[3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]methanimine