| MolName | 4-N-[(Z)-(3-nitrophenyl)methylideneamino]-2-N,2-N-diphenyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C24H18N7O3F3 |
| Smiles | [O-][N+](c1cccc(/C=N\Nc2nc(OCC(F)(F)F)nc(N(c3ccccc3)c3ccccc3)n2)c1)=O |
| InChI | InChI=1S/C24H18F3N7O3/c25-24(26,27)16-37-23-30-21(32-28-15-17-8-7-13-20(14-17)34(35)36)29-22(31-23)33(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-15H,16H2,(H,29,30,31,32) |
| InChIK | ZPLWMWQBENTKOW-UHFFFAOYSA-N |
| TotalMolweight | 509.447 |
| Molweight | 509.447 |
| MonoisotopicMass | 509.142322 |
| CLogP | 6.7559 |
| CLogS | -9.029 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 372.23 |
| Relative PSA | 0.26825 |
| PolarSurfaceArea | 121.35 |
| Druglikeness | -9.4201 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.43243 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-[(Z)-(3-nitrophenyl)methylideneamino]-2-N,2-N-diphenyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine | 2 - 4-N-[(Z)-(3-nitrophenyl)methylideneamino]-2-N,2-N-diphenyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine