| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-hydroxyacetamide |
| MolecularFormula | C10H10N2O4 |
| Smiles | OCC(N/N=C\c(cc1)cc2c1OCO2)=O |
| InChI | InChI=1S/C10H10N2O4/c13-5-10(14)12-11-4-7-1-2-8-9(3-7)16-6-15-8/h1-4,13H,5-6H2,(H,12,14) |
| InChIK | ZPNNDQCIQGRCMZ-UHFFFAOYSA-N |
| TotalMolweight | 222.199 |
| Molweight | 222.199 |
| MonoisotopicMass | 222.064058 |
| CLogP | 0.9425 |
| CLogS | -2.755 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 167.6 |
| Relative PSA | 0.41235 |
| PolarSurfaceArea | 80.15 |
| Druglikeness | 4.5018 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-hydroxyacetamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-hydroxyacetamide