| MolName | N-[(Z)-naphthalen-2-ylmethylideneamino]cyclopropanecarboxamide |
| MolecularFormula | C15H14N2O |
| Smiles | O=C(C1CC1)N/N=C\c1cc2ccccc2cc1 |
| InChI | InChI=1S/C15H14N2O/c18-15(13-7-8-13)17-16-10-11-5-6-12-3-1-2-4-14(12)9-11/h1-6,9-10,13H,7-8H2,(H,17,18) |
| InChIK | ZPQJUSGBKIIUPJ-UHFFFAOYSA-N |
| TotalMolweight | 238.289 |
| Molweight | 238.289 |
| MonoisotopicMass | 238.110613 |
| CLogP | 3.2703 |
| CLogS | -4.673 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 188.35 |
| Relative PSA | 0.19119 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.7208 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 3 |
| Symmetricatoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-2-ylmethylideneamino]cyclopropanecarboxamide | 2 - N-[(Z)-naphthalen-2-ylmethylideneamino]cyclopropanecarboxamide