| MolName | (2E)-2-[(Z)-naphthalen-1-ylmethylidenehydrazinylidene]-1,2-diphenylethanone |
| MolecularFormula | C25H18N2O |
| Smiles | O=C(/C(/c1ccccc1)=N/N=C\c1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H18N2O/c28-25(21-13-5-2-6-14-21)24(20-11-3-1-4-12-20)27-26-18-22-16-9-15-19-10-7-8-17-23(19)22/h1-18H |
| InChIK | ZQCLREBIUQWPCP-UHFFFAOYSA-N |
| TotalMolweight | 362.431 |
| Molweight | 362.431 |
| MonoisotopicMass | 362.141913 |
| CLogP | 6.4715 |
| CLogS | -7.414 |
| H Acceptors | 3 |
| TotalSurfaceArea | 292.86 |
| Relative PSA | 0.12313 |
| PolarSurfaceArea | 41.79 |
| Druglikeness | 2.7972 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (2E)-2-[(Z)-naphthalen-1-ylmethylidenehydrazinylidene]-1,2-diphenylethanone | 2 - (2E)-2-[(Z)-naphthalen-1-ylmethylidenehydrazinylidene]-1,2-diphenylethanone