| MolName | N-[(2Z,4E)-1-[(2Z)-2-[(4-bromo-5-iodofuran-2-yl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| MolecularFormula | C23H17N3O3BrI |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C/C=C/c1ccccc1)N/N=C\c(o1)cc(Br)c1I |
| InChI | InChI=1S/C23H17BrIN3O3/c24-19-14-18(31-21(19)25)15-26-28-23(30)20(13-7-10-16-8-3-1-4-9-16)27-22(29)17-11-5-2-6-12-17/h1-15H,(H,27,29)(H,28,30) |
| InChIK | ZQKHBYNWPBMKLI-UHFFFAOYSA-N |
| TotalMolweight | 590.21 |
| Molweight | 590.21 |
| MonoisotopicMass | 588.949801 |
| CLogP | 5.9233 |
| CLogS | -7.073 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 361.77 |
| Relative PSA | 0.20626 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 1.3943 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | 1,2-dihalo-alkene; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(2Z,4E)-1-[(2Z)-2-[(4-bromo-5-iodofuran-2-yl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide | 2 - N-[(2Z,4E)-1-[(2Z)-2-[(4-bromo-5-iodofuran-2-yl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide