| MolName | N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(2,4-dichlorophenyl)butanediamide |
| MolecularFormula | C25H19N3O2Cl2 |
| Smiles | O=C(CCC(N/N=C\c1c(cccc2)c2cc2ccccc12)=O)Nc(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C25H19Cl2N3O2/c26-18-9-10-23(22(27)14-18)29-24(31)11-12-25(32)30-28-15-21-19-7-3-1-5-16(19)13-17-6-2-4-8-20(17)21/h1-10,13-15H,11-12H2,(H,29,31)(H,30,32) |
| InChIK | ZRHFEJLTSLLUPA-UHFFFAOYSA-N |
| TotalMolweight | 464.351 |
| Molweight | 464.351 |
| MonoisotopicMass | 463.085431 |
| CLogP | 6.6535 |
| CLogS | -8.749 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 343.76 |
| Relative PSA | 0.17602 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 3.6212 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(2,4-dichlorophenyl)butanediamide | 2 - N'-[(Z)-anthracen-9-ylmethylideneamino]-N-(2,4-dichlorophenyl)butanediamide