| MolName | N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-4-[(2Z)-2-[[3-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzamide |
| MolecularFormula | C23H16N4OF6 |
| Smiles | O=C(c(cc1)ccc1N/N=C\c1cccc(C(F)(F)F)c1)N/N=C\c1cc(C(F)(F)F)ccc1 |
| InChI | InChI=1S/C23H16F6N4O/c24-22(25,26)18-5-1-3-15(11-18)13-30-32-20-9-7-17(8-10-20)21(34)33-31-14-16-4-2-6-19(12-16)23(27,28)29/h1-14,32H,(H,33,34) |
| InChIK | ZRRPJRZUKVKNMZ-UHFFFAOYSA-N |
| TotalMolweight | 478.395 |
| Molweight | 478.395 |
| MonoisotopicMass | 478.122829 |
| CLogP | 8.0795 |
| CLogS | -6.81 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 341.89 |
| Relative PSA | 0.17251 |
| PolarSurfaceArea | 65.85 |
| Druglikeness | -2.7213 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-4-[(2Z)-2-[[3-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzamide | 2 - N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-4-[(2Z)-2-[[3-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzamide