| MolName | 2-hydroxy-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-phenylacetamide |
| MolecularFormula | C15H14N2O3 |
| Smiles | OC(C(N/N=C\c1cc(O)ccc1)=O)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O3/c18-13-8-4-5-11(9-13)10-16-17-15(20)14(19)12-6-2-1-3-7-12/h1-10,14,18-19H,(H,17,20)/t14-/m1/s1 |
| InChIK | ZRUFBIGCWGMYEU-CQSZACIVSA-N |
| TotalMolweight | 270.287 |
| Molweight | 270.287 |
| MonoisotopicMass | 270.100443 |
| CLogP | 1.7839 |
| CLogS | -2.842 |
| H Acceptors | 5 |
| H Donors | 3 |
| TotalSurfaceArea | 212.19 |
| Relative PSA | 0.29318 |
| PolarSurfaceArea | 81.92 |
| Druglikeness | 5.1443 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-phenylacetamide | 2 - 2-hydroxy-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-phenylacetamide