| MolName | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C25H18N4O3S |
| Smiles | [O-][N+](c(cc1)cc2c1sc(C(N/N=C\c1cn(Cc3ccccc3)c3c1cccc3)=O)c2)=O |
| InChI | InChI=1S/C25H18N4O3S/c30-25(24-13-18-12-20(29(31)32)10-11-23(18)33-24)27-26-14-19-16-28(15-17-6-2-1-3-7-17)22-9-5-4-8-21(19)22/h1-14,16H,15H2,(H,27,30) |
| InChIK | ZSAYPJPFUDOBMZ-UHFFFAOYSA-N |
| TotalMolweight | 454.509 |
| Molweight | 454.509 |
| MonoisotopicMass | 454.109961 |
| CLogP | 4.7309 |
| CLogS | -6.508 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 338.52 |
| Relative PSA | 0.27667 |
| PolarSurfaceArea | 120.45 |
| Druglikeness | 2.1196 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide