| MolName | 5-bromo-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]furan-2-carboxamide |
| MolecularFormula | C10H6N2O2Br2S |
| Smiles | O=C(c(o1)ccc1Br)N/N=C\c(s1)ccc1Br |
| InChI | InChI=1S/C10H6Br2N2O2S/c11-8-3-2-7(16-8)10(15)14-13-5-6-1-4-9(12)17-6/h1-5H,(H,14,15) |
| InChIK | ZSBPRNGLMYDPTB-UHFFFAOYSA-N |
| TotalMolweight | 378.044 |
| Molweight | 378.044 |
| MonoisotopicMass | 375.85167 |
| CLogP | 4.0094 |
| CLogS | -4.861 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 209.88 |
| Relative PSA | 0.33581 |
| PolarSurfaceArea | 82.84 |
| Druglikeness | 3.1257 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - 5-bromo-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]furan-2-carboxamide | 2 - 5-bromo-N-[(Z)-(5-bromothiophen-2-yl)methylideneamino]furan-2-carboxamide