| MolName | N-[5-[2-[(2Z)-2-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
| MolecularFormula | C27H20N6O2ClFS |
| Smiles | O=C(Cc1nnc(NC(c(cccc2)c2F)=O)s1)N/N=C\c1cn(Cc(cc2)ccc2Cl)c2c1cccc2 |
| InChI | InChI=1S/C27H20ClFN6O2S/c28-19-11-9-17(10-12-19)15-35-16-18(20-5-2-4-8-23(20)35)14-30-32-24(36)13-25-33-34-27(38-25)31-26(37)21-6-1-3-7-22(21)29/h1-12,14,16H,13,15H2,(H,32,36)(H,31,34,37) |
| InChIK | ZSGJROQALKBVFY-UHFFFAOYSA-N |
| TotalMolweight | 547.013 |
| Molweight | 547.013 |
| MonoisotopicMass | 546.104099 |
| CLogP | 5.4267 |
| CLogS | -6.433 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 402.27 |
| Relative PSA | 0.27265 |
| PolarSurfaceArea | 129.51 |
| Druglikeness | 6.6784 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60526 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2Z)-2-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide | 2 - N-[5-[2-[(2Z)-2-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide