| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]-5-thiophen-2-yltriazole-4-carboxamide |
| MolecularFormula | C20H14N8O2S |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccc3ccccc23)=O)c1-c1cccs1 |
| InChI | InChI=1S/C20H14N8O2S/c21-18-19(26-30-25-18)28-17(15-9-4-10-31-15)16(23-27-28)20(29)24-22-11-13-7-3-6-12-5-1-2-8-14(12)13/h1-11H,(H2,21,25)(H,24,29) |
| InChIK | ZSHHFUBSAFPJMH-UHFFFAOYSA-N |
| TotalMolweight | 430.451 |
| Molweight | 430.451 |
| MonoisotopicMass | 430.096042 |
| CLogP | 4.6635 |
| CLogS | -4.733 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 319.5 |
| Relative PSA | 0.42723 |
| PolarSurfaceArea | 165.35 |
| Druglikeness | 3.506 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]-5-thiophen-2-yltriazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]-5-thiophen-2-yltriazole-4-carboxamide