| MolName | (2Z)-1,2-diphenyl-2-[(Z)-(4-phenylphenyl)methylidenehydrazinylidene]ethanone |
| MolecularFormula | C27H20N2O |
| Smiles | O=C(/C(/c1ccccc1)=N\N=C/c(cc1)ccc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H20N2O/c30-27(25-14-8-3-9-15-25)26(24-12-6-2-7-13-24)29-28-20-21-16-18-23(19-17-21)22-10-4-1-5-11-22/h1-20H |
| InChIK | ZSOXBFJZDNWWAD-UHFFFAOYSA-N |
| TotalMolweight | 388.469 |
| Molweight | 388.469 |
| MonoisotopicMass | 388.157563 |
| CLogP | 6.9363 |
| CLogS | -7.894 |
| H Acceptors | 3 |
| TotalSurfaceArea | 318.02 |
| Relative PSA | 0.11339 |
| PolarSurfaceArea | 41.79 |
| Druglikeness | 2.7972 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-1,2-diphenyl-2-[(Z)-(4-phenylphenyl)methylidenehydrazinylidene]ethanone | 2 - (2Z)-1,2-diphenyl-2-[(Z)-(4-phenylphenyl)methylidenehydrazinylidene]ethanone