| MolName | 6-(azepan-1-yl)-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C23H23N9O6 |
| Smiles | [O-][N+](c(cc1)ccc1Nc1nc(N/N=C\c(cc2OCOc2c2)c2[N+]([O-])=O)nc(N2CCCCCC2)n1)=O |
| InChI | InChI=1S/C23H23N9O6/c33-31(34)17-7-5-16(6-8-17)25-21-26-22(28-23(27-21)30-9-3-1-2-4-10-30)29-24-13-15-11-19-20(38-14-37-19)12-18(15)32(35)36/h5-8,11-13H,1-4,9-10,14H2,(H2,25,26,27,28,29) |
| InChIK | ZSRVQCVDWWNBOJ-UHFFFAOYSA-N |
| TotalMolweight | 521.493 |
| Molweight | 521.493 |
| MonoisotopicMass | 521.177131 |
| CLogP | 4.7249 |
| CLogS | -7.806 |
| H Acceptors | 15 |
| H Donors | 2 |
| TotalSurfaceArea | 383.7 |
| Relative PSA | 0.39544 |
| PolarSurfaceArea | 188.43 |
| Druglikeness | -5.1152 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.47368 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 11 |
| Symmetricatoms | 5 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 6-(azepan-1-yl)-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine | 2 - 6-(azepan-1-yl)-2-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine